Quorumpeps Molecule

Quorumpeps®

ALILTLVS

Quorumpeps moleculeID17
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)CO)C(C)C)CC(C)C)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C)CC(C)C)C(C)CC)CC(C)C)C(O)C
Molecular formulaC39H72N8O11
Chemical information
Species origin
Functionality
Literature