Quorumpeps Molecule

Quorumpeps®

YSTSDFIM, lacton linkage between S4 and M8

Quorumpeps moleculeID177
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)C(C)CC)Cc2ccccc2)CC(=O)O)C(O)C)CO)C(N)Cc3ccc(O)cc3
Molecular formulaC43H60N8O14S
Chemical information
Species origin
Functionality
Literature