Quorumpeps Molecule

Quorumpeps®

ARNQT

Quorumpeps moleculeID18
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C)CCCNC(=[N@H])N)CC(=O)N)CCC(=O)N
Molecular formulaC22H40N10O9
Chemical information
Species origin
Functionality
Literature