Quorumpeps Molecule

Quorumpeps®

SIFTLVA

Quorumpeps moleculeID184
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)C(C)CC)Cc1ccccc1)C(O)C)CC(C)C)C(C)C)C
Molecular formulaC36H59N7O10
Chemical information
Species origin
Functionality
Literature