Quorumpeps Molecule

Quorumpeps®

SKDYN

Quorumpeps moleculeID186
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CCCCN)CC(=O)O)Cc1ccc(O)cc1)CC(=O)N
Molecular formulaC26H39N7O11
Chemical information
Species origin
Functionality
Literature