Quorumpeps Molecule

Quorumpeps®

NNWNN

Quorumpeps moleculeID19
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)CC(=O)N)Cc2c1ccccc1nc2)CC(=O)N)CC(=O)N
Molecular formulaC27H36N10O10
Chemical information
Quorumpeps moleculeID19
SequenceNNWNN
Trivial namesEDF, Extracellular death factor
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)CC(=O)N)Cc2c1ccccc1nc2)CC(=O)N)CC(=O)N
Molecular formulaC27H36N10O10
Molecular weight660.7299999999999
LogP-7.17
Isoelectric point (pl)5.29
Species origin
Functionality
Literature