Quorumpeps Molecule

Quorumpeps®

SRKAT

Quorumpeps moleculeID191
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CCCNC(=[N@H])N)CCCCN)C
Molecular formulaC22H43N9O8
Chemical information
Species origin
Functionality
Literature