Quorumpeps Molecule

Quorumpeps®

SRNAT

Quorumpeps moleculeID192
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CCCNC(=[N@H])N)CC(=O)N)C
Molecular formulaC20H37N9O9
Chemical information
Species origin
Functionality
Literature