Quorumpeps Molecule

Quorumpeps®

SSACVWCV, thiolacton linkage between C4 and V8

Quorumpeps moleculeID194
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)C(C)C)CS)Cc3c2ccccc2nc3)C(C)C)C)CO)C(N)CO
Molecular formulaC36H53N9O10S2
Chemical information
Species origin
Functionality
Literature