Quorumpeps Molecule

Quorumpeps®

Ac-CSSLF, thiolacton linkage between C1 and F5, S2 is N-methylated

Quorumpeps moleculeID197
SMILESO=C1SCC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ccccc2)CC(C)C)CO)CO)C)NC(=O)C
Molecular formulaC27H39N5O8S1
Chemical information
Species origin
Functionality
Literature