Quorumpeps Molecule

Quorumpeps®

Ac-C(5-aminopentanoic acid)LF, thiolacton linkage between C1 and F3

Quorumpeps moleculeID199
SMILESO=C1SCC(C(=O)NCCCCC(=O)NC(C(=O)NC1Cc2ccccc2)CC(C)C)NC(=O)C
Molecular formulaC25H36N4O5S1
Chemical information
Species origin
Functionality
Literature