Quorumpeps Molecule

Quorumpeps®

YSPITNF-NH2

Quorumpeps moleculeID2
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)C(C)CC)C3N(C(=O)C(NC(=O)C(N)Cc2ccc(O)cc2)CO)CCC3
Molecular formulaC40H57N9O11
Chemical information
Species origin
Functionality
Literature