Quorumpeps Molecule

Quorumpeps®

AVNACSSLF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID20
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)CC(C)C)CO)CO)C)CC(=O)N)C(C)C)C(N)C
Molecular formulaC39H60N10O12S
Chemical information
Species origin
Literature