Quorumpeps Molecule

Quorumpeps®

Ac-(2,3-diaminopropanoic acid)SSLF, lactam linkage between (2,3-diaminopropanoic acid) and F4

Quorumpeps moleculeID200
SMILESO=C1NC(C(=O)NC(C(=O)NC(C(=O)NCC(NC(=O)C)C(=O)NC1CO)Cc2ccccc2)CC(C)C)CO
Molecular formulaC26H38N6O8
Chemical information
Species origin
Functionality
Literature