Quorumpeps Molecule

Quorumpeps®

(3-sulfanylpropanoic acid)SSLF, thiolacton linkage between (3-sulfanylpropanoic acid) and F4

Quorumpeps moleculeID201
SMILESO=C1SCCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ccccc2)CC(C)C)CO)CO
Molecular formulaC24H34N4O7S1
Chemical information
Species origin
Functionality
Literature