Quorumpeps Molecule

Quorumpeps®

4-(4-benzylphenoxy)butanoic acid-STCAFIM, thiolacton linkage between C3 and M7

Quorumpeps moleculeID202
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)C)C(O)C)CO)CCCOc3ccc(cc3)Cc4ccccc4
Molecular formulaC50H67N7O11S2
Chemical information
Species origin
Functionality
Literature