Quorumpeps Molecule

Quorumpeps®

4-(4-benzoylphenoxy)butanoic acid-STCAFIM, thiolacton linkage between C3 and M7

Quorumpeps moleculeID203
SMILESO=C(c1ccccc1)c4ccc(OCCCC(=O)NC(C(=O)NC(C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CCSC)C(C)CC)Cc3ccccc3)C)C(O)C)CO)cc4
Molecular formulaC50H65N7O12S2
Chemical information
Species origin
Functionality
Literature