Quorumpeps Molecule

Quorumpeps®

YSTCDFI-CH(-A)-COOH, thiolacton linkage between C4 and COOH-terminus

Quorumpeps moleculeID204
SMILESO=C(O)C(N)(C)C1C(=O)SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)C(C)CC)Cc2ccccc2)CC(=O)O)NC(=O)C(NC(=O)C(NC(=O)C(N)Cc3ccc(O)cc3)CO)C(O)C
Molecular formulaC43H59N9O15S1
Chemical information
Species origin
Functionality
Literature