Quorumpeps Molecule

Quorumpeps®

SVKPCTGFA, thiolacton linkage between C5 and A9

Quorumpeps moleculeID205
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)SC2)C)Cc3ccccc3)C(O)C)CCCCN)C(C)C)C(N)CO
Molecular formulaC40H62N10O11S
Chemical information
Species origin
Literature