Quorumpeps Molecule

Quorumpeps®

SYPGWSW

Quorumpeps moleculeID206
SMILESO=C(NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)Cc2c1ccccc1nc2)CO)Cc4c3ccccc3nc4)C6N(C(=O)C(NC(=O)C(N)CO)Cc5ccc(O)cc5)CCC6
Molecular formulaC44H51N9O11
Chemical information
Species origin
Functionality
Literature