Quorumpeps Molecule

Quorumpeps®

TREW(farnesyl)DG

Quorumpeps moleculeID209
SMILESO=C(O)CNC(=O)C(NC(=O)C2N(C(=O)C(NC(=O)C(NC(=O)C(N)C(O)C)CCCNC(=[N@H])N)CCC(=O)O)C3Nc1ccccc1C3(C2)C\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)CC(=O)O
Molecular formulaC47H70N10O12
Chemical information
Species origin
Functionality
Literature