Quorumpeps Molecule

Quorumpeps®

QNSPNIFGQBal3M, lacton linkage between S3 and M11

Quorumpeps moleculeID21
SMILESO=C(N)CCC(N)C(=O)NC(C(=O)NC2C(=O)N1CCCC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)CCSC)Cc3c4ccccc4sc3)CCC(=O)N)Cc5ccccc5)C(C)CC)CC(=O)N)CC(=O)N
Molecular formulaC59H81N15O16S2
Chemical information
Species origin
Functionality
Literature