Quorumpeps Molecule

Quorumpeps®

VAVLVLGA

Quorumpeps moleculeID210
SMILESO=C(NC(C(=O)O)C)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C(C)C)C)C(C)C)CC(C)C)C(C)C)CC(C)C
Molecular formulaC35H64N8O9
Chemical information
Species origin
Functionality
Literature