Quorumpeps Molecule

Quorumpeps®

VGARPCGGFF, thiolacton linkage between C6 and F10

Quorumpeps moleculeID211
SMILESO=C(NCC(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)SC2)Cc3ccccc3)Cc4ccccc4)CCCNC(=[N@H])N)C)C(N)C(C)C
Molecular formulaC46H65N13O10S
Chemical information
Species origin
Literature