Quorumpeps Molecule

Quorumpeps®

VPFEF

Quorumpeps moleculeID212
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(N)C(C)C)CCC3
Molecular formulaC33H43N5O8
Chemical information
Species origin
Functionality
Literature