Quorumpeps Molecule

Quorumpeps®

WPFAHWPWQYPR

Quorumpeps moleculeID214
SMILESO=C(N1C(C(=O)NC(C(=O)O)CCCNC(=[N@H])N)CCC1)C(NC(=O)C(NC(=O)C(NC(=O)C9N(C(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C4N(C(=O)C(N)Cc3c2ccccc2nc3)CCC4)Cc5ccccc5)C)Cc6cncn6)Cc8c7ccccc7nc8)CCC9)Cc%11c%10ccccc%10nc%11)CCC(=O)N)Cc%12ccc(O)cc%12
Molecular formulaC86H103N21O15
Chemical information
Species origin
Functionality
Literature