Quorumpeps Molecule

Quorumpeps®

YNPCANYL, thiolacton linkage between C4 and L8

Quorumpeps moleculeID216
SMILESO=C(N)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N2CCCC2C(=O)NC3C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC3)CC(C)C)Cc4ccc(O)cc4)CC(=O)N)C
Molecular formulaC43H58N10O12S
Chemical information
Species origin
Functionality
Literature