Quorumpeps Molecule

Quorumpeps®

YNPCVGYF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID219
SMILESO=C(N)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N2CCCC2C(=O)NC3C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)SC3)Cc4ccccc4)Cc5ccc(O)cc5)C(C)C
Molecular formulaC46H57N9O11S
Chemical information
Species origin
Literature