Quorumpeps Molecule

Quorumpeps®

CVGIW, thiolacton linkage between C1 and W5

Quorumpeps moleculeID22
SMILESO=C1SCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC1Cc3c2ccccc2nc3)C(C)CC)C(C)C)N
Molecular formulaC27H38N6O5S1
Chemical information
Species origin
Functionality
Literature