Quorumpeps Molecule

Quorumpeps®

YNPCLGFI, thiolacton linkage between C4 and I8

Quorumpeps moleculeID220
SMILESO=C(N)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N2CCCC2C(=O)NC3C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)SC3)C(C)CC)Cc4ccccc4)CC(C)C
Molecular formulaC44H61N9O10S
Chemical information
Species origin
Literature