Quorumpeps Molecule

Quorumpeps®

IFW(Geranyl)EQ

Quorumpeps moleculeID221
SMILESO=C(O)C(NC(=O)C(NC(=O)C3N(C(=O)C(NC(=O)C(N)C(C)CC)Cc1ccccc1)C4Nc2ccccc2C4(C3)C/C=C(/C)CC\C=C(/C)C)CCC(=O)O)CCC(=O)N
Molecular formulaC46H63N7O9
Chemical information
Species origin
Functionality
Literature