Quorumpeps Molecule

Quorumpeps®

GAFW(Geranyl)EQ

Quorumpeps moleculeID222
SMILESO=C(O)C(NC(=O)C(NC(=O)C3N(C(=O)C(NC(=O)C(NC(=O)CN)C)Cc1ccccc1)C4Nc2ccccc2C4(C3)C\C=C(/C)CC\C=C(/C)C)CCC(=O)O)CCC(=O)N
Molecular formulaC45H60N8O10
Chemical information
Species origin
Functionality
Literature