Quorumpeps Molecule

Quorumpeps®

YSTCAbuFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID223
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)CC)C(O)C)CO)C(N)Cc3ccc(O)cc3
Molecular formulaC43H62N8O11S2
Chemical information
Species origin
Functionality
Literature