Quorumpeps Molecule

Quorumpeps®

YSTCSYYF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID224
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)Cc4ccc(O)cc4)CO)C(O)C)CO)C(N)Cc5ccc(O)cc5
Molecular formulaC49H58N8O14S
Chemical information
Species origin
Literature