Quorumpeps Molecule

Quorumpeps®

ETIIIIGGG

Quorumpeps moleculeID225
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NCC(=O)NCC(=O)O)C(C)CC)C(C)CC)C(C)CC)C(C)CC)C(NC(=O)C(N)CCC(=O)O)C(O)C
Molecular formulaC39H69N9O13
Chemical information
Species origin
Functionality
Literature