Quorumpeps Molecule

Quorumpeps®

DILIIVGG

Quorumpeps moleculeID226
SMILESO=C(NCC(=O)O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)O)C(C)CC)CC(C)C)C(C)CC)C(C)CC)C(C)C
Molecular formulaC37H66N8O11
Chemical information
Species origin
Functionality
Literature