Quorumpeps Molecule

Quorumpeps®

EIIIIVGG

Quorumpeps moleculeID228
SMILESO=C(NCC(=O)O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCC(=O)O)C(C)CC)C(C)CC)C(C)CC)C(C)CC)C(C)C
Molecular formulaC38H68N8O11
Chemical information
Species origin
Functionality
Literature