Quorumpeps Molecule

Quorumpeps®

EGIIVIVVG

Quorumpeps moleculeID229
SMILESO=C(NCC(=O)O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(N)CCC(=O)O)C(C)CC)C(C)CC)C(C)C)C(C)CC)C(C)C)C(C)C
Molecular formulaC42H75N9O12
Chemical information
Species origin
Functionality
Literature