Quorumpeps Molecule

Quorumpeps®

ADPITRQW(Farnesyl)GD

Quorumpeps moleculeID23
SMILESO=C(O)CC(NC(=O)C(N)C)C(=O)N1CCCC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N3C(C(=O)NCC(=O)NC(C(=O)O)CC(=O)O)CC4(c2c(cccc2)NC34)C\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)CCC(=O)N)CCCNC(=[N@H])N)C(O)C)C(C)CC
Molecular formulaC65H99N15O17
Chemical information
Species origin
Functionality
Literature