Quorumpeps Molecule

Quorumpeps®

AILPYFAGCL

Quorumpeps moleculeID230
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)O)CC(C)C)CS)C)Cc1ccccc1)Cc2ccc(O)cc2)C3N(C(=O)C(NC(=O)C(NC(=O)C(N)C)C(C)CC)CC(C)C)CCC3
Molecular formulaC52H78N10O12S
Chemical information
Species origin
Functionality
Literature