Quorumpeps Molecule

Quorumpeps®

GLDWWSL

Quorumpeps moleculeID231
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN)CC(C)C)CC(=O)O)Cc2c1ccccc1nc2)Cc4c3ccccc3nc4)CO)CC(C)C
Molecular formulaC43H57N9O11
Chemical information
Species origin
Functionality
Literature