Quorumpeps Molecule

Quorumpeps®

SAVDWWRL

Quorumpeps moleculeID233
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)C)C(C)C)CC(=O)O)Cc2c1ccccc1nc2)Cc4c3ccccc3nc4)CCCNC(=[N@H])N)CC(C)C
Molecular formulaC49H69N13O12
Chemical information
Species origin
Functionality
Literature