Quorumpeps Molecule

Quorumpeps®

EFDWWNLG

Quorumpeps moleculeID234
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCC(=O)O)Cc1ccccc1)CC(=O)O)Cc3c2ccccc2nc3)Cc5c4ccccc4nc5)CC(=O)N)CC(C)C
Molecular formulaC52H63N11O14
Chemical information
Species origin
Functionality
Literature