Quorumpeps Molecule

Quorumpeps®

DIIIIFPPFG

Quorumpeps moleculeID235
SMILESO=C(NC(C(=O)NCC(=O)O)Cc1ccccc1)C4N(C(=O)C3N(C(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)O)C(C)CC)C(C)CC)C(C)CC)C(C)CC)Cc2ccccc2)CCC3)CCC4
Molecular formula C58H86N10O13
Chemical information
Species origin
Functionality
Literature