Quorumpeps Molecule

Quorumpeps®

RGQQNE

Quorumpeps moleculeID238
SMILESO=C(NC(C(=O)O)CCC(=O)O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(N)CCCNC(=[N@H])N)CCC(=O)N)CCC(=O)N)CC(=O)N
Molecular formulaC27H46N12O12
Chemical information
Species origin
Functionality
Literature