Quorumpeps Molecule

Quorumpeps®

INEQTVVTK

Quorumpeps moleculeID239
SMILESO=C(NC(C(=O)O)CCCCN)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C(C)CC)CC(=O)N)CCC(=O)O)CCC(=O)N)C(O)C)C(C)C)C(C)C)C(O)C
Molecular formulaC44H78N12O16
Chemical information
Species origin
Functionality
Literature