Quorumpeps Molecule

Quorumpeps®

A(Abu)F(Abu)LPGGGGVA(Abu)L(Abu)(Dha)EAI, cyclisation between (Ala1-S-Abu2), (Abu4-S-Ala12), (Abu13-S-Ala18) and (Ile19-NH-CH=CH-S-Abu15)

Quorumpeps moleculeID24
SMILESO=C6NC(C(=O)N1CCCC1C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC3C(=O)NC(C(=O)NC2C(=O)NC(/C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC=CSC2C)C(C)CC)CSC3C)CCC(=O)O)=C)CC(C)C)CSC(C)C6NC(=O)C(NC(=O)C4NC(=O)C(N)CSC4C)Cc5ccccc5)C(C)C)CC(C)C
Molecular formulaC80H120N20O21S4
Chemical information
Species origin
Functionality
Literature