Quorumpeps Molecule

Quorumpeps®

VEVSDDGSGGNTSLSQ

Quorumpeps moleculeID240
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)CCC(=O)N)CO)CC(C)C)CO)C(O)C)CC(=O)N)CO)CC(=O)O)CC(=O)O)CO)C(C)C)CCC(=O)O)C(N)C(C)C
Molecular formulaC60H98N18O30
Chemical information
Species origin
Functionality
Literature