Quorumpeps Molecule

Quorumpeps®

APKLSDGAAAGYVTKA

Quorumpeps moleculeID241
SMILESO=C(NC(C(=O)NC(C(=O)O)C)CCCCN)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C1N(C(=O)C(N)C)CCC1)CCCCN)CC(C)C)CO)CC(=O)O)C)C)C)Cc2ccc(O)cc2)C(C)C)C(O)C
Molecular formulaC67H110N18O22
Chemical information
Species origin
Functionality
Literature