Quorumpeps Molecule

Quorumpeps®

NFGAPGGAYPW

Quorumpeps moleculeID242
SMILESO=C(NC(C(=O)O)Cc2c1ccccc1nc2)C6N(C(=O)C(NC(=O)C(NC(=O)CNC(=O)CNC(=O)C4N(C(=O)C(NC(=O)CNC(=O)C(NC(=O)C(N)CC(=O)N)Cc3ccccc3)C)CCC4)C)Cc5ccc(O)cc5)CCC6
Molecular formulaC55H69N13O14
Chemical information
Species origin
Functionality
Literature